Главная | Случайная
Обратная связь

ТОР 5 статей:

Методические подходы к анализу финансового состояния предприятия

Проблема периодизации русской литературы ХХ века. Краткая характеристика второй половины ХХ века

Ценовые и неценовые факторы

Характеристика шлифовальных кругов и ее маркировка

Служебные части речи. Предлог. Союз. Частицы

КАТЕГОРИИ:






Контрольные задания. 361.Исходя из степени окисления хлора в соединениях НСl, НСlО4, НСlО3 определите, какое из них является только окислителем




361.Исходя из степени окисления хлора в соединениях НСl, НСlО4, НСlО3 определите, какое из них является только окислителем, только восстановителем, а какое может проявлять как окислительные, так и восстановительные свойства. Почему? На основании электронных уравнений расставьте коэффициенты в уравнении реакции, идущей по схеме:

КВr + KBrO3 + H2SO4 → Br2 + K2SO4 + H2O.

362. Реакция выражается схемами

Р + НIO3 + H2O → H3PO4 + HI,

H2S + Cl2 + H2O → H2SO4 + HCl.

Составьте электронные уравнения. Расставьте коэффициенты в уравнениях реакций. Для каждой реакции укажите, какое вещество является окислителем, какое – восстановителем; какое вещество окисляется, какое – восстанавливается.

363. См. условие задачи 362.
FeSO4 + KClO3 + H2SO4 = Fe2(SO4)3 + KCl + H2O,
Cu + H2SO4,конц = CuSO4 + SO2 + H2O.

364. См. условие задачи 362.
Br2 + HNO2 + H2O = HNO3 + HBr,
MnO2 + O2 + KOH = K2MnO4 + H2O.

365. См. условие задачи 362.
KMnO4 + HCl = KCl + MnCl2 + Cl2 + H2O,
Zn + HNO3,разб = Zn(NO3)2 + N2O + H2O.

366. Составьте электронные уравнения и укажите, какой процесс – окисление или восстановление – происходит при следующих превращениях: Аs-3 → Аs+5; N+3 → N-3; S-2 → S0.

На основании электронных уравнений расставьте коэффициенты в уравнении реакции, идущей по схеме:

Na2SO3 + KMnO4 + H2O → Na2SO4 + MnO2 + KOH.

367. См. условие задачи 362.

KMnO4 + FeSO4+H2SO4 = Fe2(SO4)3 + MnSO4+K2SO4 +H2O,

HNO3 + HCl = NOCl + H2O + Cl2.

368. См. условие задачи 362.
CrCl3 + Br2 + KOH = K2CrO4 + KBr + H2O + KCl,
KMnO4 + H2S + H2SO4 = K2SO4 + MnSO4 + S + H2O.

369.Исходя из степени окисления фосфора в соединениях РН3, Н3РО4, Н3РО3определите, какое из них является только окислителем, только восстановителем, а какое может проявлять как окислительные, так и восстановительные свойства. Почему? На основании электронных уравнений расставьте коэффициенты в уравнении реакции, идущей по схеме: РbS + HNO3 → S + Pb(NO3)2 + NO + H2O.

370.См. условие задачи 362.

KMnO4 + Na2SO3 + KOH → K2MnO4 + Na2SO4 + H2O,

P + HNO3 + H2O → H3PO4 + NO.

371. См. условие задачи 362.
CuS + HNO3 = Cu(NO3)2 + H2SO4 + NO2 + H2O,
C + HNO3,конц = CO2 + NO2 + H2O.

372. См. условие задачи 362.
NaCrO2 + Br2 + NaOH = Na2CrO4 + NaBr + H2O,
NO2 +H2O = HNO3 + HNO2.

373. См. условие задачи 362.
KBrO +MnCl2 + KOH = KBr + MnO2 + KCl + H2O,
Co + HNO3разб = Co(NO3)2 + NO + H2O.

374.Составьте электронные уравнения и укажите, какой процесс – окисление или восстановление – происходит при следующих превращениях: Mn+6 → Mn+2; Cl+5 → Cl+2; N-3 → N+5.На основании электронных уравнений расставьте коэффициенты в уравнении реакции, идущей по схеме: Сu2O + HNO3 → Cu(NO3)2 + NO + H2O.

375.См. условие задачи 362.

HNO3 + Ca → NH4NO3 + Ca(NO3)2 + H2O,

K2S + KMnO4 + H2SO4 → S + K2SO4 + MnSO4 + H2O.

376.Исходя из степени окисления хрома, иода и серы в соединениях К2Сr2О7, КI и Н2SO3 определите, какое из них является только окислителем, только восстановителем и какое может проявлять как окислительные, так и восстановительные свойства. Почему? На основании электронных расставьте коэффициенты в уравнении реакции, идущей по схеме:

NaCrO2 + PbO2 + NaOH →Na2CrO4 + Na2PbO2 + H2O.

377.См. условие задачи 362.

H2S + Cl2 + H2O → H2SO4 + HCl,

K2Cr2O7 + H2S + H2SO4 → S + Cr2(SO4)3 + K2SO4 + H2O.

378. См. условие задачи 362.

KClO3 + Na2SO3 → KCl + Na2SO4,

KMnO4 + HBr → Br2 + KBr + MnBr2 + H2O.

379.См. условие задачи 362.

P + HClO3 + H2O → H3PO4 + HCl,

H3AsO3+KMnO4+H2SO4→H3AsO4+ MnSO4 + K2SO4 + H2O.

380.См. условие задачи 362.

NaCrO2 + Br2 + NaOH → Na2CrO4 + NaBr + H2O,

FeS + HNO3 → Fe(NO3)2 + S + NO + H2O.

381. См. условие задачи 362.

HNO3(к) + Zn → NO2 + Zn(NO3)2 + H2O,

FeSO4 + KClO3 + H2SO4 → Fe2(SO4)3 + KCl + H2O.

382. См. условие задачи 362.

K2Cr2O7 + HCl → Cl2 +CrCl3 + KCl + H2O,

Au + HNO3 + HCl → AuCl3 + NO + H2O.

383.Могут ли происходить окислительно-восстановительные реакции между веществами: а) NH3 иKMnO4; б) HNO2 и HI; в) НСl и Н2Se? Почему? На основании электронных уравнений расставьте коэффициенты в уравнении реакции, идущей по схеме:

KMnO4+ KNO2 + H2SO4 → MnSO4 + KNO3 + K2SO4 + H2O.

384. См. условие задачи 362.

HCl + CrO3 → Cl2 + CrCl3 + H2O,

Cd + KMnO4 + H2SO4 → CdSO4 + K2SO4 + MnSO4 + H2O.

385. См. условие задачи 362.

I2 + NaOH → NaOI + NaI + H2O,

MnSO4+PbO2+HNO3→ HMnO4 + Pb(NO3)2 + PbSO4 + H2O.

386. См. условие задачи 362.

H2SO3 + HClO3 → H2SO4 + HCl,

FeSO4+K2Cr2O7+H2SO4→Fe2(SO4)3+Cr2(SO4)3+K2SO4+H2O.

387. См. условие задачи 362.

I2 + Cl2 + H2O → HIO3 + HCl,

FeCO3+KMnO4+H2SO4→Fe2(CO3)3+CO2+MnSO4+K2SO4+H2O.

388.Могут ли происходить окислительно-восстановительные реакции между веществами: а) РН3 и НВr;б) К2Сr2O7 и Н3РО3; в) НNO3 и H2S? На основании электронных уравнений расставьте коэффициенты в уравнении реакции, идущей по схеме:

AsH3 + HNO3 → H3AsO4 + NO2 + H2O.

389. См. условие задачи 362.

K2Cr2O7 + SnCl2 + HCl = SnCl4 + CrCl3 + KCl + H2O,

Mg + HNO3(р) = Mg(NO3)2 + N2O + H2O.

390. См. условие задачи 362.
KMnO4 + KI + H2SO4 = MnSO4 + I2 + K2SO4 + H2O,
CuO + H2 = Cu + H2O.




Не нашли, что искали? Воспользуйтесь поиском:

vikidalka.ru - 2015-2019 год. Все права принадлежат их авторам! Нарушение авторских прав | Нарушение персональных данных